![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | removebg.png | 2025-10-16 14:17 | 56K | |
![[ ]](/icons/unknown.gif) | roisforui.json | 2025-10-16 14:16 | 772 | |
![[ ]](/icons/unknown.gif) | bcdat_TilesLearner_OUT.json | 2025-10-16 14:16 | 1.7K | |
![[ ]](/icons/unknown.gif) | TilesLearner_OUT.json | 2025-10-16 14:16 | 194K | |
![[DIR]](/icons/folder.gif) | QUALIFY/ | 2025-10-16 14:16 | - | |
![[ ]](/icons/unknown.gif) | TilesLearner_IN.json | 2025-10-16 14:16 | 33K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_2.json | 2025-10-16 14:16 | 518 | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_2.json | 2025-10-16 14:16 | 5.5K | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_2.json | 2025-10-16 14:16 | 5.7K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_1.json | 2025-10-16 14:16 | 10K | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_1.json | 2025-10-16 14:16 | 27K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'30'_0.0.acib.png | 2025-10-16 14:16 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'29'_0.0.acib.png | 2025-10-16 14:16 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'28'_0.0.acib.png | 2025-10-16 14:16 | 3.5K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'27'_0.0.acib.png | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'26'_0.0.acib.png | 2025-10-16 14:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'25'_0.0.acib.png | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'24'_0.0.acib.png | 2025-10-16 14:16 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'23'_0.0.acib.png | 2025-10-16 14:16 | 2.9K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'22'_0.0.acib.png | 2025-10-16 14:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'21'_0.0.acib.png | 2025-10-16 14:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'20'_0.0.acib.png | 2025-10-16 14:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'19'_0.0.acib.png | 2025-10-16 14:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'18'_0.0.acib.png | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'17'_0.0.acib.png | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'16'_0.0.acib.png | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'15'_0.0.acib.png | 2025-10-16 14:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'14'_0.0.acib.png | 2025-10-16 14:16 | 3.0K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'13'_0.0.acib.png | 2025-10-16 14:16 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'12'_0.0.acib.png | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'11'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'10'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'9'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'8'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'7'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'6'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'5'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'4'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'3'_0.0.acib.png | 2025-10-16 14:16 | 11K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'2'_0.0.acib.png | 2025-10-16 14:16 | 11K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'1'_0.0.acib.png | 2025-10-16 14:16 | 11K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_d874a4ae-e3eb-4664-ba15-4138320e8c0b_'0'_0.0.acib.png | 2025-10-16 14:16 | 12K | |
![[ ]](/icons/binary.gif) | 68f1447f1b925_image,ki(AKAZE),tp(5),sz(0),ch(3),th(0.001),oc(4),ol(4),di(3),mk(3000),sc(1600).kpts.bin | 2025-10-16 14:16 | 262K | |
![[ ]](/icons/unknown.gif) | 68f1447f1b925_image.kpts.json | 2025-10-16 14:16 | 791K | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_1.json | 2025-10-16 14:16 | 16K | |
![[ ]](/icons/unknown.gif) | bcdat_AutoTiler_OUT.json | 2025-10-16 14:16 | 76 | |
![[ ]](/icons/unknown.gif) | AutoTiler_OUT.json | 2025-10-16 14:16 | 9.1K | |
![[IMG]](/icons/image2.gif) | 68f1447f1b925_image.png | 2025-10-16 14:16 | 18M | |
![[ ]](/icons/unknown.gif) | AutoTiler_IN.json | 2025-10-16 14:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | 68f1447f1d8d5_image.jpg | 2025-10-16 14:16 | 3.7M | |
![[IMG]](/icons/image2.gif) | 68f1447f1b925_image.jpg | 2025-10-16 14:16 | 3.1M | |
![[IMG]](/icons/image2.gif) | mask.png | 2025-10-16 14:16 | 92K | |
![[IMG]](/icons/image2.gif) | image.jpg | 2025-10-16 14:16 | 3.1M | |
|