![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 68f70790d3bd2_capture_1761019769.png | 2025-10-20 23:09 | 14M | |
![[IMG]](/icons/image2.gif) | 68f70790d50b1_capture_1761019783.jpg | 2025-10-20 23:09 | 2.2M | |
![[IMG]](/icons/image2.gif) | capture_1761019769.jpg | 2025-10-20 23:09 | 2.2M | |
![[IMG]](/icons/image2.gif) | 68f70790d3bd2_capture_1761019769.jpg | 2025-10-20 23:09 | 2.2M | |
![[ ]](/icons/unknown.gif) | 68f70790d3bd2_capture_1761019769.kpts.json | 2025-10-20 23:10 | 591K | |
![[ ]](/icons/unknown.gif) | TilesLearner_OUT.json | 2025-10-20 23:10 | 493K | |
![[IMG]](/icons/image2.gif) | mask.png | 2025-10-20 23:09 | 262K | |
![[IMG]](/icons/image2.gif) | removebg.png | 2025-10-20 23:10 | 215K | |
![[ ]](/icons/binary.gif) | 68f70790d3bd2_capture_1761019769,ki(AKAZE),tp(5),sz(0),ch(3),th(0.001),oc(4),ol(4),di(3),mk(3000),sc(1600).kpts.bin | 2025-10-20 23:10 | 200K | |
![[ ]](/icons/unknown.gif) | TilesLearner_IN.json | 2025-10-20 23:10 | 72K | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_1.json | 2025-10-20 23:10 | 64K | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_1.json | 2025-10-20 23:09 | 36K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_1.json | 2025-10-20 23:10 | 27K | |
![[IMG]](/icons/image2.gif) | wireframe.png | 2025-10-20 23:09 | 23K | |
![[ ]](/icons/unknown.gif) | AutoTiler_OUT.json | 2025-10-20 23:09 | 19K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'26'_0.0.acib.png | 2025-10-20 23:10 | 16K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'31'_0.0.acib.png | 2025-10-20 23:10 | 16K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'37'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'34'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'43'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'49'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'17'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'25'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'46'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'35'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'11'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'40'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'23'_0.0.acib.png | 2025-10-20 23:10 | 15K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'20'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'32'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'27'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'29'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'50'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'16'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'45'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'14'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'42'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'10'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'22'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'21'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'28'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'41'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'9'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'39'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'52'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'19'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'48'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'7'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'12'_0.0.acib.png | 2025-10-20 23:10 | 14K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'15'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'53'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'47'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'30'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'38'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'36'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'1'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'54'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'51'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'2'_0.0.acib.png | 2025-10-20 23:10 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'33'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'4'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'44'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'13'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'18'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'8'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'5'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'6'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'24'_0.0.acib.png | 2025-10-20 23:10 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'0'_0.0.acib.png | 2025-10-20 23:10 | 11K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'3'_0.0.acib.png | 2025-10-20 23:10 | 11K | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_2.json | 2025-10-20 23:10 | 5.9K | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_2.json | 2025-10-20 23:10 | 5.7K | |
![[ ]](/icons/unknown.gif) | bcdat_TilesLearner_OUT.json | 2025-10-20 23:10 | 4.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'81'_0.0.acib.png | 2025-10-20 23:10 | 4.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'70'_0.0.acib.png | 2025-10-20 23:10 | 4.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'78'_0.0.acib.png | 2025-10-20 23:10 | 4.1K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'65'_0.0.acib.png | 2025-10-20 23:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'79'_0.0.acib.png | 2025-10-20 23:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'83'_0.0.acib.png | 2025-10-20 23:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'77'_0.0.acib.png | 2025-10-20 23:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'68'_0.0.acib.png | 2025-10-20 23:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'80'_0.0.acib.png | 2025-10-20 23:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'56'_0.0.acib.png | 2025-10-20 23:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'72'_0.0.acib.png | 2025-10-20 23:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'60'_0.0.acib.png | 2025-10-20 23:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'66'_0.0.acib.png | 2025-10-20 23:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'74'_0.0.acib.png | 2025-10-20 23:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'62'_0.0.acib.png | 2025-10-20 23:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'58'_0.0.acib.png | 2025-10-20 23:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'64'_0.0.acib.png | 2025-10-20 23:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'67'_0.0.acib.png | 2025-10-20 23:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'55'_0.0.acib.png | 2025-10-20 23:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'57'_0.0.acib.png | 2025-10-20 23:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'82'_0.0.acib.png | 2025-10-20 23:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'59'_0.0.acib.png | 2025-10-20 23:10 | 3.5K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'63'_0.0.acib.png | 2025-10-20 23:10 | 3.5K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'61'_0.0.acib.png | 2025-10-20 23:10 | 3.2K | |
![[ ]](/icons/unknown.gif) | AutoTiler_IN.json | 2025-10-20 23:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'69'_0.0.acib.png | 2025-10-20 23:10 | 3.0K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'71'_0.0.acib.png | 2025-10-20 23:10 | 2.9K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'76'_0.0.acib.png | 2025-10-20 23:10 | 2.9K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'73'_0.0.acib.png | 2025-10-20 23:10 | 2.8K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_cfff3ee9-55eb-462b-8767-3ea9a5ddde7a_'75'_0.0.acib.png | 2025-10-20 23:10 | 2.8K | |
![[ ]](/icons/unknown.gif) | roisforui.json | 2025-10-20 23:10 | 2.3K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_2.json | 2025-10-20 23:10 | 526 | |
![[ ]](/icons/unknown.gif) | bcdat_AutoTiler_OUT.json | 2025-10-20 23:09 | 76 | |
![[DIR]](/icons/folder.gif) | QUALIFY/ | 2025-10-20 23:10 | - | |
|