![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | capture_1761183325.jpg | 2025-10-22 20:35 | 3.2M | |
![[IMG]](/icons/image2.gif) | removebg.png | 2025-10-22 20:35 | 493K | |
![[IMG]](/icons/image2.gif) | wireframe.png | 2025-10-22 20:35 | 30K | |
![[IMG]](/icons/image2.gif) | mask.png | 2025-10-22 20:35 | 257K | |
![[IMG]](/icons/image2.gif) | 68f9867f52878_capture_1761183325.jpg | 2025-10-22 20:35 | 3.2M | |
![[IMG]](/icons/image2.gif) | 68f9867f54d8c_capture_1761183342.jpg | 2025-10-22 20:35 | 2.8M | |
![[ ]](/icons/unknown.gif) | AutoTiler_IN.json | 2025-10-22 20:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | 68f9867f52878_capture_1761183325.png | 2025-10-22 20:36 | 19M | |
![[ ]](/icons/unknown.gif) | AutoTiler_OUT.json | 2025-10-22 20:36 | 7.0K | |
![[ ]](/icons/unknown.gif) | bcdat_AutoTiler_OUT.json | 2025-10-22 20:36 | 76 | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_1.json | 2025-10-22 20:36 | 12K | |
![[ ]](/icons/binary.gif) | 68f9867f52878_capture_1761183325,ki(AKAZE),tp(5),sz(0),ch(3),th(0.001),oc(4),ol(4),di(3),mk(3000),sc(1600).kpts.bin | 2025-10-22 20:36 | 262K | |
![[ ]](/icons/unknown.gif) | 68f9867f52878_capture_1761183325.kpts.json | 2025-10-22 20:36 | 795K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'0'_0.0.acib.png | 2025-10-22 20:36 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'1'_0.0.acib.png | 2025-10-22 20:36 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'2'_0.0.acib.png | 2025-10-22 20:36 | 13K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'3'_0.0.acib.png | 2025-10-22 20:36 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'4'_0.0.acib.png | 2025-10-22 20:36 | 12K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'5'_0.0.acib.png | 2025-10-22 20:36 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'6'_0.0.acib.png | 2025-10-22 20:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'7'_0.0.acib.png | 2025-10-22 20:36 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'8'_0.0.acib.png | 2025-10-22 20:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'9'_0.0.acib.png | 2025-10-22 20:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'10'_0.0.acib.png | 2025-10-22 20:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'11'_0.0.acib.png | 2025-10-22 20:36 | 3.3K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'12'_0.0.acib.png | 2025-10-22 20:36 | 3.5K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'13'_0.0.acib.png | 2025-10-22 20:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'14'_0.0.acib.png | 2025-10-22 20:36 | 3.6K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'15'_0.0.acib.png | 2025-10-22 20:36 | 3.5K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'16'_0.0.acib.png | 2025-10-22 20:36 | 3.5K | |
![[IMG]](/icons/image2.gif) | AUTO_P1_bfa2d168-9f84-44c3-87a6-50fa36eea518_'17'_0.0.acib.png | 2025-10-22 20:36 | 3.5K | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_1.json | 2025-10-22 20:36 | 19K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_1.json | 2025-10-22 20:36 | 6.1K | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_2.json | 2025-10-22 20:36 | 6.0K | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_2.json | 2025-10-22 20:36 | 5.8K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_2.json | 2025-10-22 20:36 | 528 | |
![[ ]](/icons/unknown.gif) | TilesLearner_IN.json | 2025-10-22 20:36 | 24K | |
![[DIR]](/icons/folder.gif) | QUALIFY/ | 2025-10-22 20:36 | - | |
![[ ]](/icons/unknown.gif) | TilesLearner_OUT.json | 2025-10-22 20:36 | 120K | |
![[ ]](/icons/unknown.gif) | bcdat_TilesLearner_OUT.json | 2025-10-22 20:36 | 1.1K | |
![[ ]](/icons/unknown.gif) | roisforui.json | 2025-10-22 20:36 | 384 | |
|