![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | orig_img_1_capture_1761005798.jpg | 2025-10-20 19:18 | 3.0M | |
![[ ]](/icons/unknown.gif) | luxlock_GenericAdb.pkpass | 2025-10-20 19:18 | 1.2M | |
![[ ]](/icons/unknown.gif) | img_1_capture_1761005798.kpts.json | 2025-10-20 19:18 | 793K | |
![[IMG]](/icons/image2.gif) | img_1_capture_1761005798.jpg | 2025-10-20 19:18 | 3.0M | |
![[ ]](/icons/binary.gif) | img_1_capture_1761005798,ki(AKAZE),tp(5),sz(0),ch(3),th(0.001),oc(4),ol(4),di(3),mk(3000),sc(1600).kpts.bin | 2025-10-20 19:18 | 262K | |
![[ ]](/icons/unknown.gif) | bcdat_Roiprocess_OUT_0.json | 2025-10-20 19:18 | 143K | |
![[ ]](/icons/unknown.gif) | annotations.json | 2025-10-20 19:18 | 2.1K | |
![[ ]](/icons/unknown.gif) | Roiprocess_OUT_0.json | 2025-10-20 19:18 | 12K | |
![[ ]](/icons/unknown.gif) | Roiprocess_IN_0.json | 2025-10-20 19:18 | 6.5K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'30'_0.0.acib.png | 2025-10-20 19:18 | 3.6K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'28'_0.0.acib.png | 2025-10-20 19:18 | 3.7K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'23'_0.0.acib.png | 2025-10-20 19:18 | 15K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'20'_0.0.acib.png | 2025-10-20 19:18 | 14K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'14'_0.0.acib.png | 2025-10-20 19:18 | 13K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'9'_0.0.acib.png | 2025-10-20 19:18 | 13K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'8'_0.0.acib.png | 2025-10-20 19:18 | 14K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'5'_0.0.acib.png | 2025-10-20 19:18 | 14K | |
![[IMG]](/icons/image2.gif) | Generic_P1_65e9f883-893a-4309-9a11-ee600564d077_'1'_0.0.acib.png | 2025-10-20 19:18 | 13K | |
|